C33H49N3O6 — CID 59218104
[1-[(2R,4R,5R)-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-2-yl]-3-methylbutan-2-yl] N,N-dimethylcarbamate (PubChem CID 59218104) has the molecular formula C33H49N3O6 and a molecular weight of 583.77 g/mol. Its IUPAC name is [1-[(2R,4R,5R)-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-2-yl]-3-methylbutan-2-yl] N,N-dimethylcarbamate.
| Compound Name | [1-[(2R,4R,5R)-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-2-yl]-3-methylbutan-2-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 59218104 |
| Molecular Formula | C33H49N3O6 |
| Molecular Weight | 583.77 g/mol |
| Exact Mass | 583.36 |
| IUPAC Name | [1-[(2R,4R,5R)-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-2-yl]-3-methylbutan-2-yl] N,N-dimethylcarbamate |
| SMILES | COCCCN1CCOc2ccc(CO[C@H]3CN[C@@H](CC(OC(=O)N(C)C)C(C)C)C[C@@H]3c3ccc(OC)cc3)cc21 |
| InChI | InChI=1S/C33H49N3O6/c1-23(2)31(42-33(37)35(3)4)20-26-19-28(25-9-11-27(39-6)12-10-25)32(21-34-26)41-22-24-8-13-30-29(18-24)36(15-17-40-30)14-7-16-38-5/h8-13,18,23,26,28,31-32,34H,7,14-17,19-22H2,1-6H3/t26-,28-,31?,32+/m1/s1 |
| InChIKey | TVUDGYSRVQQZMU-DLWFOZATSA-N |
| XLogP | 5.07 |
| TPSA | 81.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.77 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|