C33H45N7O9 — CID 145497117
[2-[4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-2-yl]-1-(2H-tetrazol-5-yl)ethyl] 5-nitrooxypentanoate (PubChem CID 145497117) has the molecular formula C33H45N7O9 and a molecular weight of 683.76 g/mol. Its IUPAC name is [2-[4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-2-yl]-1-(2H-tetrazol-5-yl)ethyl] 5-nitrooxypentanoate.
| Compound Name | [2-[4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-2-yl]-1-(2H-tetrazol-5-yl)ethyl] 5-nitrooxypentanoate |
|---|---|
| PubChem CID | 145497117 |
| Molecular Formula | C33H45N7O9 |
| Molecular Weight | 683.76 g/mol |
| Exact Mass | 683.33 |
| IUPAC Name | [2-[4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-2-yl]-1-(2H-tetrazol-5-yl)ethyl] 5-nitrooxypentanoate |
| SMILES | COCCCN1CCOc2ccc(COC3CNC(CC(OC(=O)CCCCO[N+](=O)[O-])c4nn[nH]n4)CC3c3ccc(OC)cc3)cc21 |
| InChI | InChI=1S/C33H45N7O9/c1-44-15-5-13-39-14-17-46-29-12-7-23(18-28(29)39)22-47-31-21-34-25(19-27(31)24-8-10-26(45-2)11-9-24)20-30(33-35-37-38-36-33)49-32(41)6-3-4-16-48-40(42)43/h7-12,18,25,27,30-31,34H,3-6,13-17,19-22H2,1-2H3,(H,35,36,37,38) |
| InChIKey | VEUIACARHIYLII-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 185.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.76 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|