C34H51N7O9 — CID 145497101
[6-[2-[(3Z)-3-hydrazinyl-3-hydrazinylidene-2-hydroxypropyl]-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-1-yl]-6-oxohexyl] nitrate (PubChem CID 145497101) has the molecular formula C34H51N7O9 and a molecular weight of 701.82 g/mol. Its IUPAC name is [6-[2-[(3Z)-3-hydrazinyl-3-hydrazinylidene-2-hydroxypropyl]-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-1-yl]-6-oxohexyl] nitrate.
| Compound Name | [6-[2-[(3Z)-3-hydrazinyl-3-hydrazinylidene-2-hydroxypropyl]-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-1-yl]-6-oxohexyl] nitrate |
|---|---|
| PubChem CID | 145497101 |
| Molecular Formula | C34H51N7O9 |
| Molecular Weight | 701.82 g/mol |
| Exact Mass | 701.37 |
| IUPAC Name | [6-[2-[(3Z)-3-hydrazinyl-3-hydrazinylidene-2-hydroxypropyl]-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-1-yl]-6-oxohexyl] nitrate |
| SMILES | COCCCN1CCOc2ccc(COC3CN(C(=O)CCCCCO[N+](=O)[O-])C(CC(O)/C(=N/N)NN)CC3c3ccc(OC)cc3)cc21 |
| InChI | InChI=1S/C34H51N7O9/c1-46-16-6-14-39-15-18-48-31-13-8-24(19-29(31)39)23-49-32-22-40(33(43)7-4-3-5-17-50-41(44)45)26(21-30(42)34(37-35)38-36)20-28(32)25-9-11-27(47-2)12-10-25/h8-13,19,26,28,30,32,42H,3-7,14-18,20-23,35-36H2,1-2H3,(H,37,38) |
| InChIKey | HXDWVSPHDUXTNJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 209.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.82 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|