C39H57N3O12 — CID 66884630
tert-butyl (3R,4S,5S)-4-(4-methoxyphenyl)-3-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-5-[3-(6-nitrooxyhexanoyloxy)propoxy]piperidine-1-carboxylate (PubChem CID 66884630) has the molecular formula C39H57N3O12 and a molecular weight of 759.89 g/mol. Its IUPAC name is tert-butyl (3R,4S,5S)-4-(4-methoxyphenyl)-3-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-5-[3-(6-nitrooxyhexanoyloxy)propoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4S,5S)-4-(4-methoxyphenyl)-3-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-5-[3-(6-nitrooxyhexanoyloxy)propoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 66884630 |
| Molecular Formula | C39H57N3O12 |
| Molecular Weight | 759.89 g/mol |
| Exact Mass | 759.39 |
| IUPAC Name | tert-butyl (3R,4S,5S)-4-(4-methoxyphenyl)-3-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-5-[3-(6-nitrooxyhexanoyloxy)propoxy]piperidine-1-carboxylate |
| SMILES | COCCCN1CCOc2ccc(CO[C@H]3CN(C(=O)OC(C)(C)C)C[C@@H](OCCCOC(=O)CCCCCO[N+](=O)[O-])[C@@H]3c3ccc(OC)cc3)cc21 |
| InChI | InChI=1S/C39H57N3O12/c1-39(2,3)54-38(44)41-26-34(49-21-10-22-51-36(43)11-7-6-8-23-53-42(45)46)37(30-13-15-31(48-5)16-14-30)35(27-41)52-28-29-12-17-33-32(25-29)40(19-24-50-33)18-9-20-47-4/h12-17,25,34-35,37H,6-11,18-24,26-28H2,1-5H3/t34-,35+,37+/m1/s1 |
| InChIKey | QWLHQPRYGNOFHU-FZRAEROJSA-N |
| XLogP | 5.94 |
| TPSA | 157.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.89 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|