C39H50N2O8 — CID 90930187
benzyl (3R,4S,5S)-4-[4-(3-methoxypropoxy)phenyl]-3-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-5-prop-2-enoxypiperidine-1-carboxylate (PubChem CID 90930187) has the molecular formula C39H50N2O8 and a molecular weight of 674.84 g/mol. Its IUPAC name is benzyl (3R,4S,5S)-4-[4-(3-methoxypropoxy)phenyl]-3-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-5-prop-2-enoxypiperidine-1-carboxylate.
| Compound Name | benzyl (3R,4S,5S)-4-[4-(3-methoxypropoxy)phenyl]-3-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-5-prop-2-enoxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 90930187 |
| Molecular Formula | C39H50N2O8 |
| Molecular Weight | 674.84 g/mol |
| Exact Mass | 674.36 |
| IUPAC Name | benzyl (3R,4S,5S)-4-[4-(3-methoxypropoxy)phenyl]-3-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-5-prop-2-enoxypiperidine-1-carboxylate |
| SMILES | C=CCO[C@@H]1CN(C(=O)OCc2ccccc2)C[C@H](OCc2ccc3c(c2)N(CCCOC)CCO3)[C@H]1c1ccc(OCCCOC)cc1 |
| InChI | InChI=1S/C39H50N2O8/c1-4-20-46-36-26-41(39(42)49-28-30-10-6-5-7-11-30)27-37(38(36)32-13-15-33(16-14-32)45-23-9-22-44-3)48-29-31-12-17-35-34(25-31)40(19-24-47-35)18-8-21-43-2/h4-7,10-17,25,36-38H,1,8-9,18-24,26-29H2,2-3H3/t36-,37+,38+/m1/s1 |
| InChIKey | TUZOTSBLJZCPNC-XWTVRQILSA-N |
| XLogP | 6.23 |
| TPSA | 88.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.84 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|