C36H44N2O8 — CID 86626690
benzyl (3R,4R,5S)-4-(4-methoxyphenyl)-3-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-5-[[(2S)-oxiran-2-yl]methoxy]piperidine-1-carboxylate (PubChem CID 86626690) has the molecular formula C36H44N2O8 and a molecular weight of 632.75 g/mol. Its IUPAC name is benzyl (3R,4R,5S)-4-(4-methoxyphenyl)-3-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-5-[[(2S)-oxiran-2-yl]methoxy]piperidine-1-carboxylate.
| Compound Name | benzyl (3R,4R,5S)-4-(4-methoxyphenyl)-3-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-5-[[(2S)-oxiran-2-yl]methoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 86626690 |
| Molecular Formula | C36H44N2O8 |
| Molecular Weight | 632.75 g/mol |
| Exact Mass | 632.31 |
| IUPAC Name | benzyl (3R,4R,5S)-4-(4-methoxyphenyl)-3-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-5-[[(2S)-oxiran-2-yl]methoxy]piperidine-1-carboxylate |
| SMILES | COCCCN1CCOc2ccc(CO[C@H]3CN(C(=O)OCc4ccccc4)C[C@@H](OC[C@@H]4CO4)[C@@H]3c3ccc(OC)cc3)cc21 |
| InChI | InChI=1S/C36H44N2O8/c1-40-17-6-15-37-16-18-42-32-14-9-27(19-31(32)37)23-44-33-20-38(36(39)46-22-26-7-4-3-5-8-26)21-34(45-25-30-24-43-30)35(33)28-10-12-29(41-2)13-11-28/h3-5,7-14,19,30,33-35H,6,15-18,20-25H2,1-2H3/t30-,33-,34+,35+/m0/s1 |
| InChIKey | XYIRWFIDFRPZCM-YCHQCXCDSA-N |
| XLogP | 5.04 |
| TPSA | 91.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.75 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|