C46H61N3O8Si — CID 68574530
benzyl 3-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-4-[4-(1-oxidopyridin-1-ium-2-yl)oxyphenyl]-5-tri(propan-2-yl)silyloxypiperidine-1-carboxylate (PubChem CID 68574530) has the molecular formula C46H61N3O8Si and a molecular weight of 812.09 g/mol. Its IUPAC name is benzyl 3-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-4-[4-(1-oxidopyridin-1-ium-2-yl)oxyphenyl]-5-tri(propan-2-yl)silyloxypiperidine-1-carboxylate.
| Compound Name | benzyl 3-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-4-[4-(1-oxidopyridin-1-ium-2-yl)oxyphenyl]-5-tri(propan-2-yl)silyloxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 68574530 |
| Molecular Formula | C46H61N3O8Si |
| Molecular Weight | 812.09 g/mol |
| Exact Mass | 811.42 |
| IUPAC Name | benzyl 3-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-4-[4-(1-oxidopyridin-1-ium-2-yl)oxyphenyl]-5-tri(propan-2-yl)silyloxypiperidine-1-carboxylate |
| SMILES | COCCCN1CCOc2ccc(COC3CN(C(=O)OCc4ccccc4)CC(O[Si](C(C)C)(C(C)C)C(C)C)C3c3ccc(Oc4cccc[n+]4[O-])cc3)cc21 |
| InChI | InChI=1S/C46H61N3O8Si/c1-33(2)58(34(3)4,35(5)6)57-43-30-48(46(50)55-31-36-14-9-8-10-15-36)29-42(45(43)38-18-20-39(21-19-38)56-44-16-11-12-24-49(44)51)54-32-37-17-22-41-40(28-37)47(25-27-53-41)23-13-26-52-7/h8-12,14-22,24,28,33-35,42-43,45H,13,23,25-27,29-32H2,1-7H3 |
| InChIKey | YWFUHHHJXSAQIO-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 105.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.09 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|