C33H46N2O9 — CID 87592421
(3R,4R,5S)-4-[4-(4-methoxybutoxy)phenyl]-3-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-5-[[(2R)-oxiran-2-yl]methoxy]piperidine-1-carboxylic acid (PubChem CID 87592421) has the molecular formula C33H46N2O9 and a molecular weight of 614.74 g/mol. Its IUPAC name is (3R,4R,5S)-4-[4-(4-methoxybutoxy)phenyl]-3-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-5-[[(2R)-oxiran-2-yl]methoxy]piperidine-1-carboxylic acid.
| Compound Name | (3R,4R,5S)-4-[4-(4-methoxybutoxy)phenyl]-3-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-5-[[(2R)-oxiran-2-yl]methoxy]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 87592421 |
| Molecular Formula | C33H46N2O9 |
| Molecular Weight | 614.74 g/mol |
| Exact Mass | 614.32 |
| IUPAC Name | (3R,4R,5S)-4-[4-(4-methoxybutoxy)phenyl]-3-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-5-[[(2R)-oxiran-2-yl]methoxy]piperidine-1-carboxylic acid |
| SMILES | COCCCCOc1ccc([C@@H]2[C@@H](OCc3ccc4c(c3)N(CCCOC)CCO4)CN(C(=O)O)C[C@H]2OC[C@H]2CO2)cc1 |
| InChI | InChI=1S/C33H46N2O9/c1-38-14-3-4-16-40-26-9-7-25(8-10-26)32-30(19-35(33(36)37)20-31(32)44-23-27-22-42-27)43-21-24-6-11-29-28(18-24)34(13-17-41-29)12-5-15-39-2/h6-11,18,27,30-32H,3-5,12-17,19-23H2,1-2H3,(H,36,37)/t27-,30+,31-,32-/m1/s1 |
| InChIKey | OEFNNCXVRAUXKO-PNEQTXRNSA-N |
| XLogP | 4.17 |
| TPSA | 111.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.74 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|