C36H55N3O7 — CID 67336412
tert-butyl (3R,4R,5R)-3-(aminomethyl)-4-[4-[[(2R)-2-ethoxypropoxy]methyl]phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidine-1-carboxylate (PubChem CID 67336412) has the molecular formula C36H55N3O7 and a molecular weight of 641.85 g/mol. Its IUPAC name is tert-butyl (3R,4R,5R)-3-(aminomethyl)-4-[4-[[(2R)-2-ethoxypropoxy]methyl]phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4R,5R)-3-(aminomethyl)-4-[4-[[(2R)-2-ethoxypropoxy]methyl]phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67336412 |
| Molecular Formula | C36H55N3O7 |
| Molecular Weight | 641.85 g/mol |
| Exact Mass | 641.40 |
| IUPAC Name | tert-butyl (3R,4R,5R)-3-(aminomethyl)-4-[4-[[(2R)-2-ethoxypropoxy]methyl]phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidine-1-carboxylate |
| SMILES | CCO[C@H](C)COCc1ccc([C@H]2[C@H](CN)CN(C(=O)OC(C)(C)C)C[C@@H]2OCc2ccc3c(c2)N(CCCOC)CCO3)cc1 |
| InChI | InChI=1S/C36H55N3O7/c1-7-43-26(2)23-42-24-27-9-12-29(13-10-27)34-30(20-37)21-39(35(40)46-36(3,4)5)22-33(34)45-25-28-11-14-32-31(19-28)38(16-18-44-32)15-8-17-41-6/h9-14,19,26,30,33-34H,7-8,15-18,20-25,37H2,1-6H3/t26-,30-,33+,34+/m1/s1 |
| InChIKey | OZYJKZUDYXYDBR-GQXWUIARSA-N |
| XLogP | 5.36 |
| TPSA | 104.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.85 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|