C37H56N2O9 — CID 66886291
(3S,4S,5R)-2-tert-butyl-3-[(3R)-3-hydroxybutoxy]-4-[4-(2-methoxyethoxymethyl)phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidine-1-carboxylic acid (PubChem CID 66886291) has the molecular formula C37H56N2O9 and a molecular weight of 672.86 g/mol. Its IUPAC name is (3S,4S,5R)-2-tert-butyl-3-[(3R)-3-hydroxybutoxy]-4-[4-(2-methoxyethoxymethyl)phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidine-1-carboxylic acid.
| Compound Name | (3S,4S,5R)-2-tert-butyl-3-[(3R)-3-hydroxybutoxy]-4-[4-(2-methoxyethoxymethyl)phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 66886291 |
| Molecular Formula | C37H56N2O9 |
| Molecular Weight | 672.86 g/mol |
| Exact Mass | 672.40 |
| IUPAC Name | (3S,4S,5R)-2-tert-butyl-3-[(3R)-3-hydroxybutoxy]-4-[4-(2-methoxyethoxymethyl)phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidine-1-carboxylic acid |
| SMILES | COCCCN1CCOc2ccc(CO[C@H]3CN(C(=O)O)C(C(C)(C)C)[C@@H](OCC[C@@H](C)O)[C@H]3c3ccc(COCCOC)cc3)cc21 |
| InChI | InChI=1S/C37H56N2O9/c1-26(40)14-18-47-34-33(29-11-8-27(9-12-29)24-45-21-20-44-6)32(23-39(36(41)42)35(34)37(2,3)4)48-25-28-10-13-31-30(22-28)38(16-19-46-31)15-7-17-43-5/h8-13,22,26,32-35,40H,7,14-21,23-25H2,1-6H3,(H,41,42)/t26-,32+,33+,34+,35?/m1/s1 |
| InChIKey | VVAYPKMYGRLYFS-LMEWPCRSSA-N |
| XLogP | 5.32 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.86 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|