C33H47N3O11 — CID 66885475
(3S,4R,5R)-2-tert-butyl-3-[(2S)-2-hydroxy-3-nitrooxypropoxy]-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidine-1-carboxylic acid (PubChem CID 66885475) has the molecular formula C33H47N3O11 and a molecular weight of 661.75 g/mol. Its IUPAC name is (3S,4R,5R)-2-tert-butyl-3-[(2S)-2-hydroxy-3-nitrooxypropoxy]-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidine-1-carboxylic acid.
| Compound Name | (3S,4R,5R)-2-tert-butyl-3-[(2S)-2-hydroxy-3-nitrooxypropoxy]-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 66885475 |
| Molecular Formula | C33H47N3O11 |
| Molecular Weight | 661.75 g/mol |
| Exact Mass | 661.32 |
| IUPAC Name | (3S,4R,5R)-2-tert-butyl-3-[(2S)-2-hydroxy-3-nitrooxypropoxy]-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidine-1-carboxylic acid |
| SMILES | COCCCN1CCOc2ccc(CO[C@H]3CN(C(=O)O)C(C(C)(C)C)[C@@H](OC[C@H](O)CO[N+](=O)[O-])[C@@H]3c3ccc(OC)cc3)cc21 |
| InChI | InChI=1S/C33H47N3O11/c1-33(2,3)31-30(46-20-24(37)21-47-36(40)41)29(23-8-10-25(43-5)11-9-23)28(18-35(31)32(38)39)45-19-22-7-12-27-26(17-22)34(14-16-44-27)13-6-15-42-4/h7-12,17,24,28-31,37H,6,13-16,18-21H2,1-5H3,(H,38,39)/t24-,28-,29+,30-,31?/m0/s1 |
| InChIKey | YNEIEXLWBRVWIV-YTTGICMNSA-N |
| XLogP | 3.96 |
| TPSA | 162.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.75 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|