C33H49N3O10 — CID 66885990
[2-hydroxy-3-[(3S,4R,5R)-4-[4-[(3-methoxy-2-methylpropoxy)methyl]phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-3-yl]oxypropyl] nitrate (PubChem CID 66885990) has the molecular formula C33H49N3O10 and a molecular weight of 647.77 g/mol. Its IUPAC name is [2-hydroxy-3-[(3S,4R,5R)-4-[4-[(3-methoxy-2-methylpropoxy)methyl]phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-3-yl]oxypropyl] nitrate.
| Compound Name | [2-hydroxy-3-[(3S,4R,5R)-4-[4-[(3-methoxy-2-methylpropoxy)methyl]phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-3-yl]oxypropyl] nitrate |
|---|---|
| PubChem CID | 66885990 |
| Molecular Formula | C33H49N3O10 |
| Molecular Weight | 647.77 g/mol |
| Exact Mass | 647.34 |
| IUPAC Name | [2-hydroxy-3-[(3S,4R,5R)-4-[4-[(3-methoxy-2-methylpropoxy)methyl]phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-3-yl]oxypropyl] nitrate |
| SMILES | COCCCN1CCOc2ccc(CO[C@H]3CNC[C@@H](OCC(O)CO[N+](=O)[O-])[C@@H]3c3ccc(COCC(C)COC)cc3)cc21 |
| InChI | InChI=1S/C33H49N3O10/c1-24(18-41-3)19-42-20-25-5-8-27(9-6-25)33-31(16-34-17-32(33)45-22-28(37)23-46-36(38)39)44-21-26-7-10-30-29(15-26)35(12-14-43-30)11-4-13-40-2/h5-10,15,24,28,31-34,37H,4,11-14,16-23H2,1-3H3/t24?,28?,31-,32+,33+/m0/s1 |
| InChIKey | DJHUTYQHKWMFQG-AICQFQGPSA-N |
| XLogP | 2.95 |
| TPSA | 143.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.77 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|