C31H45N3O8 — CID 66898354
[(3S,4R,5R)-4-[4-[(3-methoxy-2-methylpropoxy)methyl]phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-3-yl]methyl nitrate (PubChem CID 66898354) has the molecular formula C31H45N3O8 and a molecular weight of 587.71 g/mol. Its IUPAC name is [(3S,4R,5R)-4-[4-[(3-methoxy-2-methylpropoxy)methyl]phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-3-yl]methyl nitrate.
| Compound Name | [(3S,4R,5R)-4-[4-[(3-methoxy-2-methylpropoxy)methyl]phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-3-yl]methyl nitrate |
|---|---|
| PubChem CID | 66898354 |
| Molecular Formula | C31H45N3O8 |
| Molecular Weight | 587.71 g/mol |
| Exact Mass | 587.32 |
| IUPAC Name | [(3S,4R,5R)-4-[4-[(3-methoxy-2-methylpropoxy)methyl]phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-3-yl]methyl nitrate |
| SMILES | COCCCN1CCOc2ccc(CO[C@H]3CNC[C@@H](CO[N+](=O)[O-])[C@@H]3c3ccc(COCC(C)COC)cc3)cc21 |
| InChI | InChI=1S/C31H45N3O8/c1-23(18-38-3)19-39-20-24-5-8-26(9-6-24)31-27(22-42-34(35)36)16-32-17-30(31)41-21-25-7-10-29-28(15-25)33(12-14-40-29)11-4-13-37-2/h5-10,15,23,27,30-32H,4,11-14,16-22H2,1-3H3/t23?,27-,30-,31-/m0/s1 |
| InChIKey | BSZUHYFAEXICAG-WRHXSACWSA-N |
| XLogP | 3.82 |
| TPSA | 113.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.71 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|