C32H47N3O9 — CID 66885581
[(2S)-1-[(3S,4R,5R)-4-[4-(4-methoxybutoxy)phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-3-yl]oxypropan-2-yl] nitrate (PubChem CID 66885581) has the molecular formula C32H47N3O9 and a molecular weight of 617.74 g/mol. Its IUPAC name is [(2S)-1-[(3S,4R,5R)-4-[4-(4-methoxybutoxy)phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-3-yl]oxypropan-2-yl] nitrate.
| Compound Name | [(2S)-1-[(3S,4R,5R)-4-[4-(4-methoxybutoxy)phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-3-yl]oxypropan-2-yl] nitrate |
|---|---|
| PubChem CID | 66885581 |
| Molecular Formula | C32H47N3O9 |
| Molecular Weight | 617.74 g/mol |
| Exact Mass | 617.33 |
| IUPAC Name | [(2S)-1-[(3S,4R,5R)-4-[4-(4-methoxybutoxy)phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-3-yl]oxypropan-2-yl] nitrate |
| SMILES | COCCCCOc1ccc([C@@H]2[C@@H](OCc3ccc4c(c3)N(CCCOC)CCO4)CNC[C@H]2OC[C@H](C)O[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C32H47N3O9/c1-24(44-35(36)37)22-42-30-20-33-21-31(32(30)26-8-10-27(11-9-26)40-17-5-4-15-38-2)43-23-25-7-12-29-28(19-25)34(14-18-41-29)13-6-16-39-3/h7-12,19,24,30-33H,4-6,13-18,20-23H2,1-3H3/t24-,30+,31-,32-/m0/s1 |
| InChIKey | NQAWITKUIOBIEA-BSCAUQEJSA-N |
| XLogP | 3.98 |
| TPSA | 123.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.74 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|