C31H38N2O5 — CID 58923196
6-[[(3R,4R,5S)-4-(4-methoxyphenyl)-5-phenoxypiperidin-3-yl]oxymethyl]-4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazine (PubChem CID 58923196) has the molecular formula C31H38N2O5 and a molecular weight of 518.65 g/mol. Its IUPAC name is 6-[[(3R,4R,5S)-4-(4-methoxyphenyl)-5-phenoxypiperidin-3-yl]oxymethyl]-4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazine.
| Compound Name | 6-[[(3R,4R,5S)-4-(4-methoxyphenyl)-5-phenoxypiperidin-3-yl]oxymethyl]-4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 58923196 |
| Molecular Formula | C31H38N2O5 |
| Molecular Weight | 518.65 g/mol |
| Exact Mass | 518.28 |
| IUPAC Name | 6-[[(3R,4R,5S)-4-(4-methoxyphenyl)-5-phenoxypiperidin-3-yl]oxymethyl]-4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazine |
| SMILES | COCCCN1CCOc2ccc(CO[C@H]3CNC[C@@H](Oc4ccccc4)[C@@H]3c3ccc(OC)cc3)cc21 |
| InChI | InChI=1S/C31H38N2O5/c1-34-17-6-15-33-16-18-36-28-14-9-23(19-27(28)33)22-37-29-20-32-21-30(38-26-7-4-3-5-8-26)31(29)24-10-12-25(35-2)13-11-24/h3-5,7-14,19,29-32H,6,15-18,20-22H2,1-2H3/t29-,30+,31+/m0/s1 |
| InChIKey | XAMXYBFJEXQCNV-OJDZSJEKSA-N |
| XLogP | 4.65 |
| TPSA | 61.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.65 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|