C29H42N4O5 — CID 42644579
3-[[(3S,4R,5R)-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-3-yl]methyl]-1,1-dimethylurea (PubChem CID 42644579) has the molecular formula C29H42N4O5 and a molecular weight of 526.68 g/mol. Its IUPAC name is 3-[[(3S,4R,5R)-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-3-yl]methyl]-1,1-dimethylurea.
| Compound Name | 3-[[(3S,4R,5R)-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-3-yl]methyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 42644579 |
| Molecular Formula | C29H42N4O5 |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 526.32 |
| IUPAC Name | 3-[[(3S,4R,5R)-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-3-yl]methyl]-1,1-dimethylurea |
| SMILES | COCCCN1CCOc2ccc(CO[C@H]3CNC[C@@H](CNC(=O)N(C)C)[C@@H]3c3ccc(OC)cc3)cc21 |
| InChI | InChI=1S/C29H42N4O5/c1-32(2)29(34)31-18-23-17-30-19-27(28(23)22-7-9-24(36-4)10-8-22)38-20-21-6-11-26-25(16-21)33(13-15-37-26)12-5-14-35-3/h6-11,16,23,27-28,30H,5,12-15,17-20H2,1-4H3,(H,31,34)/t23-,27-,28-/m0/s1 |
| InChIKey | INTTUTRMRJOQSG-RNCAPKPVSA-N |
| XLogP | 3.09 |
| TPSA | 84.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|