C32H40N2O7 — CID 67583899
(3S,5R)-4-[4-(3,4-dimethoxyphenoxy)phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-3-ol (PubChem CID 67583899) has the molecular formula C32H40N2O7 and a molecular weight of 564.68 g/mol. Its IUPAC name is (3S,5R)-4-[4-(3,4-dimethoxyphenoxy)phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-3-ol.
| Compound Name | (3S,5R)-4-[4-(3,4-dimethoxyphenoxy)phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-3-ol |
|---|---|
| PubChem CID | 67583899 |
| Molecular Formula | C32H40N2O7 |
| Molecular Weight | 564.68 g/mol |
| Exact Mass | 564.28 |
| IUPAC Name | (3S,5R)-4-[4-(3,4-dimethoxyphenoxy)phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-3-ol |
| SMILES | COCCCN1CCOc2ccc(CO[C@H]3CNC[C@@H](O)C3c3ccc(Oc4ccc(OC)c(OC)c4)cc3)cc21 |
| InChI | InChI=1S/C32H40N2O7/c1-36-15-4-13-34-14-16-39-28-11-5-22(17-26(28)34)21-40-31-20-33-19-27(35)32(31)23-6-8-24(9-7-23)41-25-10-12-29(37-2)30(18-25)38-3/h5-12,17-18,27,31-33,35H,4,13-16,19-21H2,1-3H3/t27-,31+,32?/m1/s1 |
| InChIKey | BWCVCKVYZNYVIH-CVRUWJIHSA-N |
| XLogP | 4.36 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.68 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|