C29H35N3O6 — CID 68574590
5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-4-[4-(1-oxidopyridin-1-ium-3-yl)oxyphenyl]piperidin-3-ol (PubChem CID 68574590) has the molecular formula C29H35N3O6 and a molecular weight of 521.61 g/mol. Its IUPAC name is 5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-4-[4-(1-oxidopyridin-1-ium-3-yl)oxyphenyl]piperidin-3-ol.
| Compound Name | 5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-4-[4-(1-oxidopyridin-1-ium-3-yl)oxyphenyl]piperidin-3-ol |
|---|---|
| PubChem CID | 68574590 |
| Molecular Formula | C29H35N3O6 |
| Molecular Weight | 521.61 g/mol |
| Exact Mass | 521.25 |
| IUPAC Name | 5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-4-[4-(1-oxidopyridin-1-ium-3-yl)oxyphenyl]piperidin-3-ol |
| SMILES | COCCCN1CCOc2ccc(COC3CNCC(O)C3c3ccc(Oc4ccc[n+]([O-])c4)cc3)cc21 |
| InChI | InChI=1S/C29H35N3O6/c1-35-14-3-11-31-13-15-36-27-10-5-21(16-25(27)31)20-37-28-18-30-17-26(33)29(28)22-6-8-23(9-7-22)38-24-4-2-12-32(34)19-24/h2,4-10,12,16,19,26,28-30,33H,3,11,13-15,17-18,20H2,1H3 |
| InChIKey | KPFFCWZNQDDSDY-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.61 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|