C31H37ClN2O6 — CID 68574743
4-[4-(3-chloro-4-methoxyphenoxy)phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-3-ol (PubChem CID 68574743) has the molecular formula C31H37ClN2O6 and a molecular weight of 569.10 g/mol. Its IUPAC name is 4-[4-(3-chloro-4-methoxyphenoxy)phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-3-ol.
| Compound Name | 4-[4-(3-chloro-4-methoxyphenoxy)phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-3-ol |
|---|---|
| PubChem CID | 68574743 |
| Molecular Formula | C31H37ClN2O6 |
| Molecular Weight | 569.10 g/mol |
| Exact Mass | 568.23 |
| IUPAC Name | 4-[4-(3-chloro-4-methoxyphenoxy)phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-3-ol |
| SMILES | COCCCN1CCOc2ccc(COC3CNCC(O)C3c3ccc(Oc4ccc(OC)c(Cl)c4)cc3)cc21 |
| InChI | InChI=1S/C31H37ClN2O6/c1-36-14-3-12-34-13-15-38-29-10-4-21(16-26(29)34)20-39-30-19-33-18-27(35)31(30)22-5-7-23(8-6-22)40-24-9-11-28(37-2)25(32)17-24/h4-11,16-17,27,30-31,33,35H,3,12-15,18-20H2,1-2H3 |
| InChIKey | HETBLYCQQQDWHY-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.10 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|