C32H40N2O6 — CID 67583207
(3S,5R)-4-[4-(3-ethoxyphenoxy)phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-3-ol (PubChem CID 67583207) has the molecular formula C32H40N2O6 and a molecular weight of 548.68 g/mol. Its IUPAC name is (3S,5R)-4-[4-(3-ethoxyphenoxy)phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-3-ol.
| Compound Name | (3S,5R)-4-[4-(3-ethoxyphenoxy)phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-3-ol |
|---|---|
| PubChem CID | 67583207 |
| Molecular Formula | C32H40N2O6 |
| Molecular Weight | 548.68 g/mol |
| Exact Mass | 548.29 |
| IUPAC Name | (3S,5R)-4-[4-(3-ethoxyphenoxy)phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-3-ol |
| SMILES | CCOc1cccc(Oc2ccc(C3[C@H](O)CNC[C@@H]3OCc3ccc4c(c3)N(CCCOC)CCO4)cc2)c1 |
| InChI | InChI=1S/C32H40N2O6/c1-3-37-26-6-4-7-27(19-26)40-25-11-9-24(10-12-25)32-29(35)20-33-21-31(32)39-22-23-8-13-30-28(18-23)34(15-17-38-30)14-5-16-36-2/h4,6-13,18-19,29,31-33,35H,3,5,14-17,20-22H2,1-2H3/t29-,31+,32?/m1/s1 |
| InChIKey | MEUMJOGPQRLLRG-HKNZYLRQSA-N |
| XLogP | 4.75 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.68 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|