C29H38N4O10 — CID 68851414
(3R,4R,5R)-4-(4-methoxyphenyl)-3-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-5-[[(2-nitrooxyacetyl)amino]methyl]piperidine-1-carboxylic acid (PubChem CID 68851414) has the molecular formula C29H38N4O10 and a molecular weight of 602.64 g/mol. Its IUPAC name is (3R,4R,5R)-4-(4-methoxyphenyl)-3-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-5-[[(2-nitrooxyacetyl)amino]methyl]piperidine-1-carboxylic acid.
| Compound Name | (3R,4R,5R)-4-(4-methoxyphenyl)-3-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-5-[[(2-nitrooxyacetyl)amino]methyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 68851414 |
| Molecular Formula | C29H38N4O10 |
| Molecular Weight | 602.64 g/mol |
| Exact Mass | 602.26 |
| IUPAC Name | (3R,4R,5R)-4-(4-methoxyphenyl)-3-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-5-[[(2-nitrooxyacetyl)amino]methyl]piperidine-1-carboxylic acid |
| SMILES | COCCCN1CCOc2ccc(CO[C@H]3CN(C(=O)O)C[C@@H](CNC(=O)CO[N+](=O)[O-])[C@@H]3c3ccc(OC)cc3)cc21 |
| InChI | InChI=1S/C29H38N4O10/c1-39-12-3-10-31-11-13-41-25-9-4-20(14-24(25)31)18-42-26-17-32(29(35)36)16-22(15-30-27(34)19-43-33(37)38)28(26)21-5-7-23(40-2)8-6-21/h4-9,14,22,26,28H,3,10-13,15-19H2,1-2H3,(H,30,34)(H,35,36)/t22-,26+,28+/m1/s1 |
| InChIKey | CQUGWRRSWJFAPC-ZEZZXZOMSA-N |
| XLogP | 2.53 |
| TPSA | 162.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.64 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|