C36H48N2O7S — CID 68653075
(2R)-4-[(2R,4R,5R)-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-1-(4-methylphenyl)sulfonylpiperidin-2-yl]butan-2-ol (PubChem CID 68653075) has the molecular formula C36H48N2O7S and a molecular weight of 652.85 g/mol. Its IUPAC name is (2R)-4-[(2R,4R,5R)-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-1-(4-methylphenyl)sulfonylpiperidin-2-yl]butan-2-ol.
| Compound Name | (2R)-4-[(2R,4R,5R)-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-1-(4-methylphenyl)sulfonylpiperidin-2-yl]butan-2-ol |
|---|---|
| PubChem CID | 68653075 |
| Molecular Formula | C36H48N2O7S |
| Molecular Weight | 652.85 g/mol |
| Exact Mass | 652.32 |
| IUPAC Name | (2R)-4-[(2R,4R,5R)-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-1-(4-methylphenyl)sulfonylpiperidin-2-yl]butan-2-ol |
| SMILES | COCCCN1CCOc2ccc(CO[C@H]3CN(S(=O)(=O)c4ccc(C)cc4)[C@H](CC[C@@H](C)O)C[C@@H]3c3ccc(OC)cc3)cc21 |
| InChI | InChI=1S/C36H48N2O7S/c1-26-6-15-32(16-7-26)46(40,41)38-24-36(33(23-30(38)12-8-27(2)39)29-10-13-31(43-4)14-11-29)45-25-28-9-17-35-34(22-28)37(19-21-44-35)18-5-20-42-3/h6-7,9-11,13-17,22,27,30,33,36,39H,5,8,12,18-21,23-25H2,1-4H3/t27-,30-,33-,36+/m1/s1 |
| InChIKey | LCQLKBOHOAISQP-QVUCPDGZSA-N |
| XLogP | 5.53 |
| TPSA | 97.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.85 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|