C37H49N3O7S — CID 68687695
(2S)-2-[(2R,4R,5R)-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-1-(4-methylphenyl)sulfonylpiperidin-2-yl]-N-methylbutanamide (PubChem CID 68687695) has the molecular formula C37H49N3O7S and a molecular weight of 679.88 g/mol. Its IUPAC name is (2S)-2-[(2R,4R,5R)-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-1-(4-methylphenyl)sulfonylpiperidin-2-yl]-N-methylbutanamide.
| Compound Name | (2S)-2-[(2R,4R,5R)-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-1-(4-methylphenyl)sulfonylpiperidin-2-yl]-N-methylbutanamide |
|---|---|
| PubChem CID | 68687695 |
| Molecular Formula | C37H49N3O7S |
| Molecular Weight | 679.88 g/mol |
| Exact Mass | 679.33 |
| IUPAC Name | (2S)-2-[(2R,4R,5R)-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-1-(4-methylphenyl)sulfonylpiperidin-2-yl]-N-methylbutanamide |
| SMILES | CC[C@H](C(=O)NC)[C@H]1C[C@H](c2ccc(OC)cc2)[C@@H](OCc2ccc3c(c2)N(CCCOC)CCO3)CN1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C37H49N3O7S/c1-6-31(37(41)38-3)33-23-32(28-11-13-29(45-5)14-12-28)36(24-40(33)48(42,43)30-15-8-26(2)9-16-30)47-25-27-10-17-35-34(22-27)39(19-21-46-35)18-7-20-44-4/h8-17,22,31-33,36H,6-7,18-21,23-25H2,1-5H3,(H,38,41)/t31-,32+,33+,36-/m0/s1 |
| InChIKey | JLNGTXQCRWSBSF-LABVJWKOSA-N |
| XLogP | 5.14 |
| TPSA | 106.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.88 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|