C38H52N2O8S — CID 67061781
[(2S,4R,5R)-4-[4-[(3-methoxy-2-methylpropoxy)methyl]phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-1-(4-methylphenyl)sulfonylpiperidin-2-yl]methanol (PubChem CID 67061781) has the molecular formula C38H52N2O8S and a molecular weight of 696.91 g/mol. Its IUPAC name is [(2S,4R,5R)-4-[4-[(3-methoxy-2-methylpropoxy)methyl]phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-1-(4-methylphenyl)sulfonylpiperidin-2-yl]methanol.
| Compound Name | [(2S,4R,5R)-4-[4-[(3-methoxy-2-methylpropoxy)methyl]phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-1-(4-methylphenyl)sulfonylpiperidin-2-yl]methanol |
|---|---|
| PubChem CID | 67061781 |
| Molecular Formula | C38H52N2O8S |
| Molecular Weight | 696.91 g/mol |
| Exact Mass | 696.34 |
| IUPAC Name | [(2S,4R,5R)-4-[4-[(3-methoxy-2-methylpropoxy)methyl]phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-1-(4-methylphenyl)sulfonylpiperidin-2-yl]methanol |
| SMILES | COCCCN1CCOc2ccc(CO[C@H]3CN(S(=O)(=O)c4ccc(C)cc4)[C@H](CO)C[C@@H]3c3ccc(COCC(C)COC)cc3)cc21 |
| InChI | InChI=1S/C38H52N2O8S/c1-28-6-13-34(14-7-28)49(42,43)40-22-38(48-27-31-10-15-37-36(20-31)39(17-19-47-37)16-5-18-44-3)35(21-33(40)23-41)32-11-8-30(9-12-32)26-46-25-29(2)24-45-4/h6-15,20,29,33,35,38,41H,5,16-19,21-27H2,1-4H3/t29?,33-,35+,38-/m0/s1 |
| InChIKey | TXSOMWZPEKRBPC-OTPUSYOPSA-N |
| XLogP | 5.15 |
| TPSA | 107.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.91 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|