C39H51N3O7S — CID 67389462
2-[(2S,4R,5R)-4-[4-(2-ethoxypropoxymethyl)phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-1-(4-methylphenyl)sulfonylpiperidin-2-yl]acetonitrile (PubChem CID 67389462) has the molecular formula C39H51N3O7S and a molecular weight of 705.92 g/mol. Its IUPAC name is 2-[(2S,4R,5R)-4-[4-(2-ethoxypropoxymethyl)phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-1-(4-methylphenyl)sulfonylpiperidin-2-yl]acetonitrile.
| Compound Name | 2-[(2S,4R,5R)-4-[4-(2-ethoxypropoxymethyl)phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-1-(4-methylphenyl)sulfonylpiperidin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 67389462 |
| Molecular Formula | C39H51N3O7S |
| Molecular Weight | 705.92 g/mol |
| Exact Mass | 705.34 |
| IUPAC Name | 2-[(2S,4R,5R)-4-[4-(2-ethoxypropoxymethyl)phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-1-(4-methylphenyl)sulfonylpiperidin-2-yl]acetonitrile |
| SMILES | CCOC(C)COCc1ccc([C@H]2C[C@@H](CC#N)N(S(=O)(=O)c3ccc(C)cc3)C[C@@H]2OCc2ccc3c(c2)N(CCCOC)CCO3)cc1 |
| InChI | InChI=1S/C39H51N3O7S/c1-5-47-30(3)26-46-27-31-9-12-33(13-10-31)36-24-34(17-18-40)42(50(43,44)35-14-7-29(2)8-15-35)25-39(36)49-28-32-11-16-38-37(23-32)41(20-22-48-38)19-6-21-45-4/h7-16,23,30,34,36,39H,5-6,17,19-22,24-28H2,1-4H3/t30?,34-,36-,39+/m1/s1 |
| InChIKey | ZWZBHAYCNYKXCP-OYINLYDRSA-N |
| XLogP | 6.22 |
| TPSA | 110.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.92 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|