C37H50N2O9S2 — CID 91455899
[(2R)-1-[(2R,4R,5R)-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-1-(4-methylphenyl)sulfonylpiperidin-2-yl]butan-2-yl] methanesulfonate (PubChem CID 91455899) has the molecular formula C37H50N2O9S2 and a molecular weight of 730.95 g/mol. Its IUPAC name is [(2R)-1-[(2R,4R,5R)-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-1-(4-methylphenyl)sulfonylpiperidin-2-yl]butan-2-yl] methanesulfonate.
| Compound Name | [(2R)-1-[(2R,4R,5R)-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-1-(4-methylphenyl)sulfonylpiperidin-2-yl]butan-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 91455899 |
| Molecular Formula | C37H50N2O9S2 |
| Molecular Weight | 730.95 g/mol |
| Exact Mass | 730.30 |
| IUPAC Name | [(2R)-1-[(2R,4R,5R)-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-1-(4-methylphenyl)sulfonylpiperidin-2-yl]butan-2-yl] methanesulfonate |
| SMILES | CC[C@H](C[C@H]1C[C@H](c2ccc(OC)cc2)[C@@H](OCc2ccc3c(c2)N(CCCOC)CCO3)CN1S(=O)(=O)c1ccc(C)cc1)OS(C)(=O)=O |
| InChI | InChI=1S/C37H50N2O9S2/c1-6-31(48-49(5,40)41)23-30-24-34(29-11-13-32(45-4)14-12-29)37(25-39(30)50(42,43)33-15-8-27(2)9-16-33)47-26-28-10-17-36-35(22-28)38(19-21-46-36)18-7-20-44-3/h8-17,22,30-31,34,37H,6-7,18-21,23-26H2,1-5H3/t30-,31+,34+,37-/m0/s1 |
| InChIKey | GDVKVJHFEZXWAO-AZVJNVGYSA-N |
| XLogP | 5.52 |
| TPSA | 120.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.95 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|