C35H49N5O13 — CID 145497083
5,6-dinitrooxyhexyl 4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-2-[2-(methylamino)-2-oxoethyl]piperidine-1-carboxylate (PubChem CID 145497083) has the molecular formula C35H49N5O13 and a molecular weight of 747.80 g/mol. Its IUPAC name is 5,6-dinitrooxyhexyl 4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-2-[2-(methylamino)-2-oxoethyl]piperidine-1-carboxylate.
| Compound Name | 5,6-dinitrooxyhexyl 4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-2-[2-(methylamino)-2-oxoethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 145497083 |
| Molecular Formula | C35H49N5O13 |
| Molecular Weight | 747.80 g/mol |
| Exact Mass | 747.33 |
| IUPAC Name | 5,6-dinitrooxyhexyl 4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-2-[2-(methylamino)-2-oxoethyl]piperidine-1-carboxylate |
| SMILES | CNC(=O)CC1CC(c2ccc(OC)cc2)C(OCc2ccc3c(c2)N(CCCOC)CCO3)CN1C(=O)OCCCCC(CO[N+](=O)[O-])O[N+](=O)[O-] |
| InChI | InChI=1S/C35H49N5O13/c1-36-34(41)21-27-20-30(26-9-11-28(48-3)12-10-26)33(51-23-25-8-13-32-31(19-25)37(15-18-49-32)14-6-16-47-2)22-38(27)35(42)50-17-5-4-7-29(53-40(45)46)24-52-39(43)44/h8-13,19,27,29-30,33H,4-7,14-18,20-24H2,1-3H3,(H,36,41) |
| InChIKey | CPNRKAQSOHGFAR-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 203.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.80 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|