C30H27ClFN7O — CID 164521869
7-(8-chloronaphthalen-1-yl)-4-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-3-yl]-8-fluoro-2-(4,5,6,7-tetrahydro-1H-indazol-5-yloxy)pyrido[4,3-d]pyrimidine (PubChem CID 164521869) has the molecular formula C30H27ClFN7O and a molecular weight of 556.05 g/mol. Its IUPAC name is 7-(8-chloronaphthalen-1-yl)-4-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-3-yl]-8-fluoro-2-(4,5,6,7-tetrahydro-1H-indazol-5-yloxy)pyrido[4,3-d]pyrimidine.
| Compound Name | 7-(8-chloronaphthalen-1-yl)-4-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-3-yl]-8-fluoro-2-(4,5,6,7-tetrahydro-1H-indazol-5-yloxy)pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 164521869 |
| Molecular Formula | C30H27ClFN7O |
| Molecular Weight | 556.05 g/mol |
| Exact Mass | 555.19 |
| IUPAC Name | 7-(8-chloronaphthalen-1-yl)-4-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-3-yl]-8-fluoro-2-(4,5,6,7-tetrahydro-1H-indazol-5-yloxy)pyrido[4,3-d]pyrimidine |
| SMILES | Fc1c(-c2cccc3cccc(Cl)c23)ncc2c(N3C[C@H]4CC[C@@H](C3)N4)nc(OC3CCc4[nH]ncc4C3)nc12 |
| InChI | InChI=1S/C30H27ClFN7O/c31-23-6-2-4-16-3-1-5-21(25(16)23)27-26(32)28-22(13-33-27)29(39-14-18-7-8-19(15-39)35-18)37-30(36-28)40-20-9-10-24-17(11-20)12-34-38-24/h1-6,12-13,18-20,35H,7-11,14-15H2,(H,34,38)/t18-,19+,20? |
| InChIKey | QQVYMICEQDRKFF-YOFSQIOKSA-N |
| XLogP | 5.24 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.05 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |