C21H23NO10 — CID 164522023
methyl 2-(2-acetyl-3,4,5-trimethoxy-6-nitrophenyl)-3,4-dimethoxybenzoate (PubChem CID 164522023) has the molecular formula C21H23NO10 and a molecular weight of 449.41 g/mol. Its IUPAC name is methyl 2-(2-acetyl-3,4,5-trimethoxy-6-nitrophenyl)-3,4-dimethoxybenzoate.
| Compound Name | methyl 2-(2-acetyl-3,4,5-trimethoxy-6-nitrophenyl)-3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 164522023 |
| Molecular Formula | C21H23NO10 |
| Molecular Weight | 449.41 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | methyl 2-(2-acetyl-3,4,5-trimethoxy-6-nitrophenyl)-3,4-dimethoxybenzoate |
| SMILES | COC(=O)c1ccc(OC)c(OC)c1-c1c(C(C)=O)c(OC)c(OC)c(OC)c1[N+](=O)[O-] |
| InChI | InChI=1S/C21H23NO10/c1-10(23)13-15(16(22(25)26)19(30-5)20(31-6)18(13)29-4)14-11(21(24)32-7)8-9-12(27-2)17(14)28-3/h8-9H,1-7H3 |
| InChIKey | OLIQMYSDZJOJMY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 132.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|