C25H18F3N5O2S — CID 164522437
4-[[3-(2-amino-1,3-benzothiazol-6-yl)-5-[2-(trifluoromethyl)phenyl]pyrazol-1-yl]methyl]-N-hydroxybenzamide (PubChem CID 164522437) has the molecular formula C25H18F3N5O2S and a molecular weight of 509.51 g/mol. Its IUPAC name is 4-[[3-(2-amino-1,3-benzothiazol-6-yl)-5-[2-(trifluoromethyl)phenyl]pyrazol-1-yl]methyl]-N-hydroxybenzamide.
| Compound Name | 4-[[3-(2-amino-1,3-benzothiazol-6-yl)-5-[2-(trifluoromethyl)phenyl]pyrazol-1-yl]methyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 164522437 |
| Molecular Formula | C25H18F3N5O2S |
| Molecular Weight | 509.51 g/mol |
| Exact Mass | 509.11 |
| IUPAC Name | 4-[[3-(2-amino-1,3-benzothiazol-6-yl)-5-[2-(trifluoromethyl)phenyl]pyrazol-1-yl]methyl]-N-hydroxybenzamide |
| SMILES | Nc1nc2ccc(-c3cc(-c4ccccc4C(F)(F)F)n(Cc4ccc(C(=O)NO)cc4)n3)cc2s1 |
| InChI | InChI=1S/C25H18F3N5O2S/c26-25(27,28)18-4-2-1-3-17(18)21-12-20(16-9-10-19-22(11-16)36-24(29)30-19)31-33(21)13-14-5-7-15(8-6-14)23(34)32-35/h1-12,35H,13H2,(H2,29,30)(H,32,34) |
| InChIKey | PHKRAQJLPUCVQV-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 106.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.51 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|