C18H14N4 — CID 164523722
3-amino-6-(2-methylphenyl)-5-phenylpyrazine-2-carbonitrile (PubChem CID 164523722) has the molecular formula C18H14N4 and a molecular weight of 286.34 g/mol. Its IUPAC name is 3-amino-6-(2-methylphenyl)-5-phenylpyrazine-2-carbonitrile.
| Compound Name | 3-amino-6-(2-methylphenyl)-5-phenylpyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 164523722 |
| Molecular Formula | C18H14N4 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 3-amino-6-(2-methylphenyl)-5-phenylpyrazine-2-carbonitrile |
| SMILES | Cc1ccccc1-c1nc(C#N)c(N)nc1-c1ccccc1 |
| InChI | InChI=1S/C18H14N4/c1-12-7-5-6-10-14(12)17-16(13-8-3-2-4-9-13)22-18(20)15(11-19)21-17/h2-10H,1H3,(H2,20,22) |
| InChIKey | MJZQEQVJDXITKQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |