C29H27N5O2 — CID 164526321
N-[3-[[(7-pyridin-4-yl-2,3-dihydrofuro[3,2-c]pyridin-4-yl)amino]methyl]phenyl]-1,2,3,4-tetrahydroisoquinoline-6-carboxamide (PubChem CID 164526321) has the molecular formula C29H27N5O2 and a molecular weight of 477.57 g/mol. Its IUPAC name is N-[3-[[(7-pyridin-4-yl-2,3-dihydrofuro[3,2-c]pyridin-4-yl)amino]methyl]phenyl]-1,2,3,4-tetrahydroisoquinoline-6-carboxamide.
| Compound Name | N-[3-[[(7-pyridin-4-yl-2,3-dihydrofuro[3,2-c]pyridin-4-yl)amino]methyl]phenyl]-1,2,3,4-tetrahydroisoquinoline-6-carboxamide |
|---|---|
| PubChem CID | 164526321 |
| Molecular Formula | C29H27N5O2 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | N-[3-[[(7-pyridin-4-yl-2,3-dihydrofuro[3,2-c]pyridin-4-yl)amino]methyl]phenyl]-1,2,3,4-tetrahydroisoquinoline-6-carboxamide |
| SMILES | O=C(Nc1cccc(CNc2ncc(-c3ccncc3)c3c2CCO3)c1)c1ccc2c(c1)CCNC2 |
| InChI | InChI=1S/C29H27N5O2/c35-29(22-4-5-23-17-31-12-8-21(23)15-22)34-24-3-1-2-19(14-24)16-32-28-25-9-13-36-27(25)26(18-33-28)20-6-10-30-11-7-20/h1-7,10-11,14-15,18,31H,8-9,12-13,16-17H2,(H,32,33)(H,34,35) |
| InChIKey | WWWWFMSJEKXICM-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |