C23H23FN4O2 — CID 164526335
N-(3-fluoropropyl)-3-[[(7-pyridin-4-yl-2,3-dihydrofuro[3,2-c]pyridin-4-yl)amino]methyl]benzamide (PubChem CID 164526335) has the molecular formula C23H23FN4O2 and a molecular weight of 406.46 g/mol. Its IUPAC name is N-(3-fluoropropyl)-3-[[(7-pyridin-4-yl-2,3-dihydrofuro[3,2-c]pyridin-4-yl)amino]methyl]benzamide.
| Compound Name | N-(3-fluoropropyl)-3-[[(7-pyridin-4-yl-2,3-dihydrofuro[3,2-c]pyridin-4-yl)amino]methyl]benzamide |
|---|---|
| PubChem CID | 164526335 |
| Molecular Formula | C23H23FN4O2 |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | N-(3-fluoropropyl)-3-[[(7-pyridin-4-yl-2,3-dihydrofuro[3,2-c]pyridin-4-yl)amino]methyl]benzamide |
| SMILES | O=C(NCCCF)c1cccc(CNc2ncc(-c3ccncc3)c3c2CCO3)c1 |
| InChI | InChI=1S/C23H23FN4O2/c24-8-2-9-26-23(29)18-4-1-3-16(13-18)14-27-22-19-7-12-30-21(19)20(15-28-22)17-5-10-25-11-6-17/h1,3-6,10-11,13,15H,2,7-9,12,14H2,(H,26,29)(H,27,28) |
| InChIKey | UCLYKSMQQAEFNZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|