C23H25FN6O3 — CID 164525682
5-[[[7-(2-aminopyrimidin-4-yl)-2,3-dihydrofuro[3,2-c]pyridin-4-yl]amino]methyl]-2-fluoro-N-(3-methoxypropyl)benzamide (PubChem CID 164525682) has the molecular formula C23H25FN6O3 and a molecular weight of 452.49 g/mol. Its IUPAC name is 5-[[[7-(2-aminopyrimidin-4-yl)-2,3-dihydrofuro[3,2-c]pyridin-4-yl]amino]methyl]-2-fluoro-N-(3-methoxypropyl)benzamide.
| Compound Name | 5-[[[7-(2-aminopyrimidin-4-yl)-2,3-dihydrofuro[3,2-c]pyridin-4-yl]amino]methyl]-2-fluoro-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 164525682 |
| Molecular Formula | C23H25FN6O3 |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | 5-[[[7-(2-aminopyrimidin-4-yl)-2,3-dihydrofuro[3,2-c]pyridin-4-yl]amino]methyl]-2-fluoro-N-(3-methoxypropyl)benzamide |
| SMILES | COCCCNC(=O)c1cc(CNc2ncc(-c3ccnc(N)n3)c3c2CCO3)ccc1F |
| InChI | InChI=1S/C23H25FN6O3/c1-32-9-2-7-26-22(31)16-11-14(3-4-18(16)24)12-28-21-15-6-10-33-20(15)17(13-29-21)19-5-8-27-23(25)30-19/h3-5,8,11,13H,2,6-7,9-10,12H2,1H3,(H,26,31)(H,28,29)(H2,25,27,30) |
| InChIKey | NADGOODGCRXZFO-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 124.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|