C22H22FN5O4 — CID 164526512
N-[(4-fluoro-3-nitrophenyl)methyl]-7-[1-(oxan-2-yl)pyrazol-4-yl]-2,3-dihydrofuro[3,2-c]pyridin-4-amine (PubChem CID 164526512) has the molecular formula C22H22FN5O4 and a molecular weight of 439.45 g/mol. Its IUPAC name is N-[(4-fluoro-3-nitrophenyl)methyl]-7-[1-(oxan-2-yl)pyrazol-4-yl]-2,3-dihydrofuro[3,2-c]pyridin-4-amine.
| Compound Name | N-[(4-fluoro-3-nitrophenyl)methyl]-7-[1-(oxan-2-yl)pyrazol-4-yl]-2,3-dihydrofuro[3,2-c]pyridin-4-amine |
|---|---|
| PubChem CID | 164526512 |
| Molecular Formula | C22H22FN5O4 |
| Molecular Weight | 439.45 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | N-[(4-fluoro-3-nitrophenyl)methyl]-7-[1-(oxan-2-yl)pyrazol-4-yl]-2,3-dihydrofuro[3,2-c]pyridin-4-amine |
| SMILES | O=[N+]([O-])c1cc(CNc2ncc(-c3cnn(C4CCCCO4)c3)c3c2CCO3)ccc1F |
| InChI | InChI=1S/C22H22FN5O4/c23-18-5-4-14(9-19(18)28(29)30)10-24-22-16-6-8-32-21(16)17(12-25-22)15-11-26-27(13-15)20-3-1-2-7-31-20/h4-5,9,11-13,20H,1-3,6-8,10H2,(H,24,25) |
| InChIKey | VQNSFMRSCBIUJG-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 104.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.45 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|