C14H19N5O — CID 169084053
2-N-[[1-(oxan-2-yl)pyrazol-4-yl]methyl]pyridine-2,3-diamine (PubChem CID 169084053) has the molecular formula C14H19N5O and a molecular weight of 273.34 g/mol. Its IUPAC name is 2-N-[[1-(oxan-2-yl)pyrazol-4-yl]methyl]pyridine-2,3-diamine.
| Compound Name | 2-N-[[1-(oxan-2-yl)pyrazol-4-yl]methyl]pyridine-2,3-diamine |
|---|---|
| PubChem CID | 169084053 |
| Molecular Formula | C14H19N5O |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 2-N-[[1-(oxan-2-yl)pyrazol-4-yl]methyl]pyridine-2,3-diamine |
| SMILES | Nc1cccnc1NCc1cnn(C2CCCCO2)c1 |
| InChI | InChI=1S/C14H19N5O/c15-12-4-3-6-16-14(12)17-8-11-9-18-19(10-11)13-5-1-2-7-20-13/h3-4,6,9-10,13H,1-2,5,7-8,15H2,(H,16,17) |
| InChIKey | BOKWCWYZOVWNOZ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |