C13H27N7O — CID 164526741
2-[2-[3-[2-[bis(2-aminoethyl)amino]ethyl]-2-oxoimidazolidin-1-yl]ethylamino]acetonitrile (PubChem CID 164526741) has the molecular formula C13H27N7O and a molecular weight of 297.41 g/mol. Its IUPAC name is 2-[2-[3-[2-[bis(2-aminoethyl)amino]ethyl]-2-oxoimidazolidin-1-yl]ethylamino]acetonitrile.
| Compound Name | 2-[2-[3-[2-[bis(2-aminoethyl)amino]ethyl]-2-oxoimidazolidin-1-yl]ethylamino]acetonitrile |
|---|---|
| PubChem CID | 164526741 |
| Molecular Formula | C13H27N7O |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 297.23 |
| IUPAC Name | 2-[2-[3-[2-[bis(2-aminoethyl)amino]ethyl]-2-oxoimidazolidin-1-yl]ethylamino]acetonitrile |
| SMILES | N#CCNCCN1CCN(CCN(CCN)CCN)C1=O |
| InChI | InChI=1S/C13H27N7O/c14-1-4-17-5-8-19-11-12-20(13(19)21)10-9-18(6-2-15)7-3-16/h17H,2-12,15-16H2 |
| InChIKey | PDKNWXCGTHFLFW-UHFFFAOYSA-N |
| XLogP | -1.94 |
| TPSA | 114.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|