C15H20N8O — CID 171441821
2-[2-[3-[2-[bis(isocyanomethyl)amino]ethyl]-2-oxoimidazolidin-1-yl]ethyl-(cyanomethyl)amino]acetonitrile (PubChem CID 171441821) has the molecular formula C15H20N8O and a molecular weight of 328.38 g/mol. Its IUPAC name is 2-[2-[3-[2-[bis(isocyanomethyl)amino]ethyl]-2-oxoimidazolidin-1-yl]ethyl-(cyanomethyl)amino]acetonitrile.
| Compound Name | 2-[2-[3-[2-[bis(isocyanomethyl)amino]ethyl]-2-oxoimidazolidin-1-yl]ethyl-(cyanomethyl)amino]acetonitrile |
|---|---|
| PubChem CID | 171441821 |
| Molecular Formula | C15H20N8O |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 2-[2-[3-[2-[bis(isocyanomethyl)amino]ethyl]-2-oxoimidazolidin-1-yl]ethyl-(cyanomethyl)amino]acetonitrile |
| SMILES | [C-]#[N+]CN(CCN1CCN(CCN(CC#N)CC#N)C1=O)C[N+]#[C-] |
| InChI | InChI=1S/C15H20N8O/c1-18-13-21(14-19-2)8-10-23-12-11-22(15(23)24)9-7-20(5-3-16)6-4-17/h5-14H2 |
| InChIKey | LKZWFUGGRYLPES-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 86.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|