C25H22N6O2 — CID 158190916
2-[4-[[4-[2-[bis(isocyanomethyl)amino]-2-oxoethyl]phenyl]methyl]phenyl]-N,N-bis(cyanomethyl)acetamide (PubChem CID 158190916) has the molecular formula C25H22N6O2 and a molecular weight of 438.49 g/mol. Its IUPAC name is 2-[4-[[4-[2-[bis(isocyanomethyl)amino]-2-oxoethyl]phenyl]methyl]phenyl]-N,N-bis(cyanomethyl)acetamide.
| Compound Name | 2-[4-[[4-[2-[bis(isocyanomethyl)amino]-2-oxoethyl]phenyl]methyl]phenyl]-N,N-bis(cyanomethyl)acetamide |
|---|---|
| PubChem CID | 158190916 |
| Molecular Formula | C25H22N6O2 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 2-[4-[[4-[2-[bis(isocyanomethyl)amino]-2-oxoethyl]phenyl]methyl]phenyl]-N,N-bis(cyanomethyl)acetamide |
| SMILES | [C-]#[N+]CN(C[N+]#[C-])C(=O)Cc1ccc(Cc2ccc(CC(=O)N(CC#N)CC#N)cc2)cc1 |
| InChI | InChI=1S/C25H22N6O2/c1-28-18-31(19-29-2)25(33)17-23-9-5-21(6-10-23)15-20-3-7-22(8-4-20)16-24(32)30(13-11-26)14-12-27/h3-10H,13-19H2 |
| InChIKey | FQYIMAXLUPKNAS-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 96.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|