C17H23N3O3 — CID 86859446
tert-butyl N-[4-[2-[cyanomethyl(ethyl)amino]-2-oxoethyl]phenyl]carbamate (PubChem CID 86859446) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is tert-butyl N-[4-[2-[cyanomethyl(ethyl)amino]-2-oxoethyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[2-[cyanomethyl(ethyl)amino]-2-oxoethyl]phenyl]carbamate |
|---|---|
| PubChem CID | 86859446 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | tert-butyl N-[4-[2-[cyanomethyl(ethyl)amino]-2-oxoethyl]phenyl]carbamate |
| SMILES | CCN(CC#N)C(=O)Cc1ccc(NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C17H23N3O3/c1-5-20(11-10-18)15(21)12-13-6-8-14(9-7-13)19-16(22)23-17(2,3)4/h6-9H,5,11-12H2,1-4H3,(H,19,22) |
| InChIKey | CNFPNBCCZGKAKZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|