C15H17N3O — CID 52832632
N,N-bis(cyanomethyl)-3-(2,4-dimethylphenyl)propanamide (PubChem CID 52832632) has the molecular formula C15H17N3O and a molecular weight of 255.32 g/mol. Its IUPAC name is N,N-bis(cyanomethyl)-3-(2,4-dimethylphenyl)propanamide.
| Compound Name | N,N-bis(cyanomethyl)-3-(2,4-dimethylphenyl)propanamide |
|---|---|
| PubChem CID | 52832632 |
| Molecular Formula | C15H17N3O |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | N,N-bis(cyanomethyl)-3-(2,4-dimethylphenyl)propanamide |
| SMILES | Cc1ccc(CCC(=O)N(CC#N)CC#N)c(C)c1 |
| InChI | InChI=1S/C15H17N3O/c1-12-3-4-14(13(2)11-12)5-6-15(19)18(9-7-16)10-8-17/h3-4,11H,5-6,9-10H2,1-2H3 |
| InChIKey | ZFEIJAHEZKYEAM-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 67.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|