2-[3-(2,4-dimethylphenyl)propanoyl-methylamino]propanoic acid

C15H21NO3 — CID 119209194

IUPAC2-[3-(2,4-dimethylphenyl)propanoyl-methylamino]propanoic acid
SMILESCc1ccc(CCC(=O)N(C)C(C)C(=O)O)c(C)c1
InChIInChI=1S/C15H21NO3/c1-10-5-6-13(11(2)9-10)7-8-14(17)16(4)12(3)15(18)19/h5-6,9,12H,7-8H2,1-4H3,(H,18,19)
InChIKeyFMWQHPRFNHVKOH-UHFFFAOYSA-N
MW263.34 g/mol
LogP2.17
Rot. Bonds5

About 2-[3-(2,4-dimethylphenyl)propanoyl-methylamino]propanoic acid

2-[3-(2,4-dimethylphenyl)propanoyl-methylamino]propanoic acid (PubChem CID 119209194) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 2-[3-(2,4-dimethylphenyl)propanoyl-methylamino]propanoic acid.

Molecular Properties

Compound Name2-[3-(2,4-dimethylphenyl)propanoyl-methylamino]propanoic acid
PubChem CID119209194
Molecular FormulaC15H21NO3
Molecular Weight263.34 g/mol
Exact Mass263.15
IUPAC Name2-[3-(2,4-dimethylphenyl)propanoyl-methylamino]propanoic acid
SMILESCc1ccc(CCC(=O)N(C)C(C)C(=O)O)c(C)c1
InChIInChI=1S/C15H21NO3/c1-10-5-6-13(11(2)9-10)7-8-14(17)16(4)12(3)15(18)19/h5-6,9,12H,7-8H2,1-4H3,(H,18,19)
InChIKeyFMWQHPRFNHVKOH-UHFFFAOYSA-N
XLogP2.17
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.34
LogP ≤ 52.17
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-[3-(2,4-dimethylphenyl)propanoyl-methylamino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[3-(2,4-dimethylphenyl)propanoyl-methylamino]propanoic acid?
The IUPAC name of 2-[3-(2,4-dimethylphenyl)propanoyl-methylamino]propanoic acid (CID 119209194) is 2-[3-(2,4-dimethylphenyl)propanoyl-methylamino]propanoic acid.
What is the SMILES notation for 2-[3-(2,4-dimethylphenyl)propanoyl-methylamino]propanoic acid?
The canonical SMILES for 2-[3-(2,4-dimethylphenyl)propanoyl-methylamino]propanoic acid is Cc1ccc(CCC(=O)N(C)C(C)C(=O)O)c(C)c1.
What is the InChIKey of 2-[3-(2,4-dimethylphenyl)propanoyl-methylamino]propanoic acid?
The InChIKey is FMWQHPRFNHVKOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO3/c1-10-5-6-13(11(2)9-10)7-8-14(17)16(4)12(3)15(18)19/h5-6,9,12H,7-8H2,1-4H3,(H,18,19).
What are the key properties of 2-[3-(2,4-dimethylphenyl)propanoyl-methylamino]propanoic acid?
2-[3-(2,4-dimethylphenyl)propanoyl-methylamino]propanoic acid has a molecular weight of 263.34 g/mol, XLogP of 2.17, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(2,4-dimethylphenyl)propanoyl-methylamino]propanoic acid is sourced from PubChem (CID 119209194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).