C11H18N7O4P — CID 136623179
2-[2-(2-amino-6-oxo-7,8-dihydro-1H-purin-9-yl)ethyl-(cyanomethyl)amino]ethylphosphonic acid (PubChem CID 136623179) has the molecular formula C11H18N7O4P and a molecular weight of 343.28 g/mol. Its IUPAC name is 2-[2-(2-amino-6-oxo-7,8-dihydro-1H-purin-9-yl)ethyl-(cyanomethyl)amino]ethylphosphonic acid.
| Compound Name | 2-[2-(2-amino-6-oxo-7,8-dihydro-1H-purin-9-yl)ethyl-(cyanomethyl)amino]ethylphosphonic acid |
|---|---|
| PubChem CID | 136623179 |
| Molecular Formula | C11H18N7O4P |
| Molecular Weight | 343.28 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 2-[2-(2-amino-6-oxo-7,8-dihydro-1H-purin-9-yl)ethyl-(cyanomethyl)amino]ethylphosphonic acid |
| SMILES | N#CCN(CCN1CNc2c1nc(N)[nH]c2=O)CCP(=O)(O)O |
| InChI | InChI=1S/C11H18N7O4P/c12-1-2-17(5-6-23(20,21)22)3-4-18-7-14-8-9(18)15-11(13)16-10(8)19/h14H,2-7H2,(H2,20,21,22)(H3,13,15,16,19) |
| InChIKey | XXLYXWAKJQJABN-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 171.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.28 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|