C9H17N5NaO6P — CID 173319638
sodium;1-[(2-amino-6-oxo-7,8-dihydro-1H-purin-9-yl)methoxymethoxy]ethylphosphonic acid;hydride (PubChem CID 173319638) has the molecular formula C9H17N5NaO6P and a molecular weight of 345.23 g/mol. Its IUPAC name is sodium;1-[(2-amino-6-oxo-7,8-dihydro-1H-purin-9-yl)methoxymethoxy]ethylphosphonic acid;hydride.
| Compound Name | sodium;1-[(2-amino-6-oxo-7,8-dihydro-1H-purin-9-yl)methoxymethoxy]ethylphosphonic acid;hydride |
|---|---|
| PubChem CID | 173319638 |
| Molecular Formula | C9H17N5NaO6P |
| Molecular Weight | 345.23 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | sodium;1-[(2-amino-6-oxo-7,8-dihydro-1H-purin-9-yl)methoxymethoxy]ethylphosphonic acid;hydride |
| SMILES | CC(OCOCN1CNc2c1nc(N)[nH]c2=O)P(=O)(O)O.[H-].[Na+] |
| InChI | InChI=1S/C9H16N5O6P.Na.H/c1-5(21(16,17)18)20-4-19-3-14-2-11-6-7(14)12-9(10)13-8(6)15;;/h5,11H,2-4H2,1H3,(H2,16,17,18)(H3,10,12,13,15);;/q;+1;-1 |
| InChIKey | KXYKIQPOJMFGLK-UHFFFAOYSA-N |
| XLogP | -3.87 |
| TPSA | 163.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.23 |
| LogP ≤ 5 | -3.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|