C9H18N5O5P — CID 135724745
(2-amino-6-oxo-7,8-dihydro-1H-purin-9-yl)phosphonic acid;1-methoxypropane (PubChem CID 135724745) has the molecular formula C9H18N5O5P and a molecular weight of 307.25 g/mol. Its IUPAC name is (2-amino-6-oxo-7,8-dihydro-1H-purin-9-yl)phosphonic acid;1-methoxypropane.
| Compound Name | (2-amino-6-oxo-7,8-dihydro-1H-purin-9-yl)phosphonic acid;1-methoxypropane |
|---|---|
| PubChem CID | 135724745 |
| Molecular Formula | C9H18N5O5P |
| Molecular Weight | 307.25 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | (2-amino-6-oxo-7,8-dihydro-1H-purin-9-yl)phosphonic acid;1-methoxypropane |
| SMILES | CCCOC.Nc1nc2c(c(=O)[nH]1)NCN2P(=O)(O)O |
| InChI | InChI=1S/C5H8N5O4P.C4H10O/c6-5-8-3-2(4(11)9-5)7-1-10(3)15(12,13)14;1-3-4-5-2/h7H,1H2,(H2,12,13,14)(H3,6,8,9,11);3-4H2,1-2H3 |
| InChIKey | MDYQTGBUJIWTEW-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 153.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.25 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|