C11H16N5O6P — CID 174014372
[(2S,3E,5R)-5-(2-amino-6-oxo-7,8-dihydro-1H-purin-9-yl)-3-(hydroxymethylidene)oxolan-2-yl]methyl dihydrogen phosphite (PubChem CID 174014372) has the molecular formula C11H16N5O6P and a molecular weight of 345.25 g/mol. Its IUPAC name is [(2S,3E,5R)-5-(2-amino-6-oxo-7,8-dihydro-1H-purin-9-yl)-3-(hydroxymethylidene)oxolan-2-yl]methyl dihydrogen phosphite.
| Compound Name | [(2S,3E,5R)-5-(2-amino-6-oxo-7,8-dihydro-1H-purin-9-yl)-3-(hydroxymethylidene)oxolan-2-yl]methyl dihydrogen phosphite |
|---|---|
| PubChem CID | 174014372 |
| Molecular Formula | C11H16N5O6P |
| Molecular Weight | 345.25 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | [(2S,3E,5R)-5-(2-amino-6-oxo-7,8-dihydro-1H-purin-9-yl)-3-(hydroxymethylidene)oxolan-2-yl]methyl dihydrogen phosphite |
| SMILES | Nc1nc2c(c(=O)[nH]1)NCN2[C@H]1C/C(=C\O)[C@@H](COP(O)O)O1 |
| InChI | InChI=1S/C11H16N5O6P/c12-11-14-9-8(10(18)15-11)13-4-16(9)7-1-5(2-17)6(22-7)3-21-23(19)20/h2,6-7,13,17,19-20H,1,3-4H2,(H3,12,14,15,18)/b5-2+/t6-,7-/m1/s1 |
| InChIKey | SCMBVAKPAUFXAO-RDOFSXSHSA-N |
| XLogP | -0.67 |
| TPSA | 166.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.25 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|