C11H17N5O3 — CID 137401197
[5-(2-amino-6-methoxy-7,8-dihydropurin-9-yl)oxolan-2-yl]methanol (PubChem CID 137401197) has the molecular formula C11H17N5O3 and a molecular weight of 267.29 g/mol. Its IUPAC name is [5-(2-amino-6-methoxy-7,8-dihydropurin-9-yl)oxolan-2-yl]methanol.
| Compound Name | [5-(2-amino-6-methoxy-7,8-dihydropurin-9-yl)oxolan-2-yl]methanol |
|---|---|
| PubChem CID | 137401197 |
| Molecular Formula | C11H17N5O3 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | [5-(2-amino-6-methoxy-7,8-dihydropurin-9-yl)oxolan-2-yl]methanol |
| SMILES | COc1nc(N)nc2c1NCN2C1CCC(CO)O1 |
| InChI | InChI=1S/C11H17N5O3/c1-18-10-8-9(14-11(12)15-10)16(5-13-8)7-3-2-6(4-17)19-7/h6-7,13,17H,2-5H2,1H3,(H2,12,14,15) |
| InChIKey | VGOHKDPOXSSXTF-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |