C13H18N6O2 — CID 90758707
[(2S,5R)-5-[2-amino-6-(cyclopropylamino)-7,8-dihydropurin-9-yl]-2,5-dihydrofuran-2-yl]methanol (PubChem CID 90758707) has the molecular formula C13H18N6O2 and a molecular weight of 290.33 g/mol. Its IUPAC name is [(2S,5R)-5-[2-amino-6-(cyclopropylamino)-7,8-dihydropurin-9-yl]-2,5-dihydrofuran-2-yl]methanol.
| Compound Name | [(2S,5R)-5-[2-amino-6-(cyclopropylamino)-7,8-dihydropurin-9-yl]-2,5-dihydrofuran-2-yl]methanol |
|---|---|
| PubChem CID | 90758707 |
| Molecular Formula | C13H18N6O2 |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | [(2S,5R)-5-[2-amino-6-(cyclopropylamino)-7,8-dihydropurin-9-yl]-2,5-dihydrofuran-2-yl]methanol |
| SMILES | Nc1nc(NC2CC2)c2c(n1)N([C@H]1C=C[C@@H](CO)O1)CN2 |
| InChI | InChI=1S/C13H18N6O2/c14-13-17-11(16-7-1-2-7)10-12(18-13)19(6-15-10)9-4-3-8(5-20)21-9/h3-4,7-9,15,20H,1-2,5-6H2,(H3,14,16,17,18)/t8-,9+/m0/s1 |
| InChIKey | BGYWNOYPQAMVLK-DTWKUNHWSA-N |
| XLogP | 0.10 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|