C26H37FN7O7P — CID 123731830
methyl (2S)-2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(cyclopentylamino)-7,8-dihydropurin-9-yl]-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 123731830) has the molecular formula C26H37FN7O7P and a molecular weight of 609.60 g/mol. Its IUPAC name is methyl (2S)-2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(cyclopentylamino)-7,8-dihydropurin-9-yl]-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(cyclopentylamino)-7,8-dihydropurin-9-yl]-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 123731830 |
| Molecular Formula | C26H37FN7O7P |
| Molecular Weight | 609.60 g/mol |
| Exact Mass | 609.25 |
| IUPAC Name | methyl (2S)-2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(cyclopentylamino)-7,8-dihydropurin-9-yl]-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@H](N2CNc3c(NC4CCCC4)nc(N)nc32)[C@](C)(F)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C26H37FN7O7P/c1-15(23(36)38-3)33-42(37,41-17-11-5-4-6-12-17)39-13-18-20(35)26(2,27)24(40-18)34-14-29-19-21(30-16-9-7-8-10-16)31-25(28)32-22(19)34/h4-6,11-12,15-16,18,20,24,29,35H,7-10,13-14H2,1-3H3,(H,33,37)(H3,28,30,31,32)/t15-,18+,20+,24+,26+,42?/m0/s1 |
| InChIKey | BZUIKVZWHDCNTO-JUMSPBSPSA-N |
| XLogP | 2.77 |
| TPSA | 182.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.60 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|