C15H23N7O — CID 156545343
[4-[2-amino-6-(3-aminopyrrolidin-1-yl)-7,8-dihydropurin-9-yl]cyclopent-2-en-1-yl]methanol (PubChem CID 156545343) has the molecular formula C15H23N7O and a molecular weight of 317.40 g/mol. Its IUPAC name is [4-[2-amino-6-(3-aminopyrrolidin-1-yl)-7,8-dihydropurin-9-yl]cyclopent-2-en-1-yl]methanol.
| Compound Name | [4-[2-amino-6-(3-aminopyrrolidin-1-yl)-7,8-dihydropurin-9-yl]cyclopent-2-en-1-yl]methanol |
|---|---|
| PubChem CID | 156545343 |
| Molecular Formula | C15H23N7O |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | [4-[2-amino-6-(3-aminopyrrolidin-1-yl)-7,8-dihydropurin-9-yl]cyclopent-2-en-1-yl]methanol |
| SMILES | Nc1nc(N2CCC(N)C2)c2c(n1)N(C1C=CC(CO)C1)CN2 |
| InChI | InChI=1S/C15H23N7O/c16-10-3-4-21(6-10)13-12-14(20-15(17)19-13)22(8-18-12)11-2-1-9(5-11)7-23/h1-2,9-11,18,23H,3-8,16H2,(H2,17,19,20) |
| InChIKey | XZTAVYWUNZKYEW-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 116.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|